Alkyl chlorides
Sigma Aldrich Fine Chemicals Biosciences 2-METHYLNAPHTHALENE BETA
NC3725815 2-METHYLNAPHTHALENE BETA
Medchemexpress LLC 1-Fluoronaphthalene | 321-38-0 | 99.7% | 146.16 | 1 ML
1-Fluoronaphthalene is an organofluorine compound derived from naphthalene derivatives and fluorinated aromatics. It can be used to synthesize LY248686, a potent inhibitor of serotonin and noradrenaline uptake.
- Colorless to yellow liquid
- Appearance: Liquid
- Can be oxidized by *C.elegans* ATCC 36112 to form dihydroxy-dihydro-1-fluoronaphthalene and other compounds
- Suitable for laboratory research
eMolecules 113296-33-6 | (4-ethylcyclohexyl)methanol | MFCD20407987 | 1g
Ambeed | Cobalt(IV) sulfide | 5g | 789349279 | A1155432 | 12013-10-4 | MFCD00064735 | 125.070 | CoH2S2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 164220-57-9 | 4-(trans-4-Ethylcyclohexyl)phenylboronic acid | Combi-Blocks | MFCD12546553 | 232.130 | C14H21BO2 | 95.000 | CC[C@H]1CC[C@@H](CC1)c1ccc(cc1)B(O)O | 1g | 117524304](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502190593.JPG-250.jpg)
eMolecules 164220-57-9 | 4-(trans-4-Ethylcyclohexyl)phenylboronic acid | Combi-Blocks | MFCD12546553 | 232.130 | C14H21BO2 | 95.000 | CC[C@H]1CC[C@@H](CC1)c1ccc(cc1)B(O)O | 1g | 117524304
4-(trans-4-Ethylcyclohexyl)phenylboronic acid | Combi-Blocks | 164220-57-9 | MFCD12546553 | 232.130 | C14H21BO2 | 95.000 | CC[C@H]1CC[C@@H](CC1)c1ccc(cc1)B(O)O | 1g | 117524304
Cayman Chemical S-Tetrahydrofurn-3-ylamIn 10g
A synthetic intermediate useful for pharmaceutical synthesis.
Aobchem 1-(Methylsulfonyl)-3-(trifluoromethyl)benzene | ≥95% | CAS 43032-69-5 | C8H7F3O2S | 500mg
1-(Methylsulfonyl)-3-(trifluoromethyl)benzene | ≥95% | CAS 43032-69-5 | C8H7F3O2S | 500mg
Aobchem N-(2-Methylpropyl)-4-(trifluoromethyl)benzenemethanamine | ≥95% | CAS 637359-15-0 | C12H16F3N | 5g
N-(2-Methylpropyl)-4-(trifluoromethyl)benzenemethanamine | ≥95% | CAS 637359-15-0 | C12H16F3N | 5g
eMolecules 873-41-6 | 3,5,6-trichloro-1,2,4-triazine | Pharmablock - Stock | MFCD09033774 | 184.400 | C3Cl3N3 | 97.000 | Clc1nnc(Cl)c(Cl)n1 | 100g | 507869408
3,5,6-trichloro-1,2,4-triazine | Pharmablock - Stock | 873-41-6 | MFCD09033774 | 184.400 | C3Cl3N3 | 97.000 | Clc1nnc(Cl)c(Cl)n1 | 100g | 507869408
Aobchem 1 2 4-Trichloro-5-methylbenzene | ≥97% | CAS 6639-30-1 | C7H5Cl3 | 5g
1 2 4-Trichloro-5-methylbenzene | ≥97% | CAS 6639-30-1 | C7H5Cl3 | 5g
Aobchem 1-(Methylsulfonyl)-4-(trifluoromethyl)benzene | ≥95% | CAS 145963-48-0 | C8H7F3O2S | 250mg
1-(Methylsulfonyl)-4-(trifluoromethyl)benzene | ≥95% | CAS 145963-48-0 | C8H7F3O2S | 250mg
Aobchem 2 2 2-Trichloro-1-(2-chlorophenyl)ethanone | ≥97% | CAS 124787-08-2 | C8H4Cl4O | 500mg
2 2 2-Trichloro-1-(2-chlorophenyl)ethanone | ≥97% | CAS 124787-08-2 | C8H4Cl4O | 500mg